
CAS 1240562-12-2
:2,4-Difluoro-6-(trifluoromethyl)benzenamine
Description:
2,4-Difluoro-6-(trifluoromethyl)benzenamine is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two fluorine atoms at the 2 and 4 positions and a trifluoromethyl group at the 6 position, along with an amino group (-NH2) attached to the benzene. This compound is part of the class of fluorinated aromatic amines, which are known for their unique chemical properties due to the presence of electronegative fluorine atoms. The fluorine substituents can significantly influence the compound's reactivity, polarity, and solubility, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The presence of the amino group also suggests potential for further chemical modifications, allowing for the synthesis of derivatives with tailored properties. Additionally, the compound's fluorinated nature may impart enhanced stability and bioactivity, which are valuable in medicinal chemistry. Safety and handling considerations are essential due to the potential toxicity associated with fluorinated amines.
Formula:C7H4F5N
InChI:InChI=1S/C7H4F5N/c8-3-1-4(7(10,11)12)6(13)5(9)2-3/h1-2H,13H2
InChI key:InChIKey=PUFNGLYJOKWCQN-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(N)C(F)=CC(F)=C1
Synonyms:- 2,4-Difluoro-6-(trifluoromethyl)benzenamine
- Benzenamine, 2,4-difluoro-6-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.