CAS 1240564-33-3

1H-Pyrazol-3-amine, 1-(2-methoxyethyl)-5-methyl-

Description:

1H-Pyrazol-3-amine, 1-(2-methoxyethyl)-5-methyl- is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an amine functional group, contributing to its reactivity and potential as a building block in medicinal chemistry. The presence of a methoxyethyl group enhances its solubility in organic solvents and may influence its biological activity. The methyl group at the 5-position of the pyrazole ring can affect the compound's steric and electronic properties, potentially impacting its interaction with biological targets. This compound may exhibit various pharmacological activities, making it of interest in drug discovery and development. Its molecular structure suggests potential applications in fields such as agrochemicals or pharmaceuticals. As with many organic compounds, its stability, reactivity, and biological properties would depend on the specific conditions under which it is studied, including pH, temperature, and the presence of other chemical species.

Formula: C₇H₁₃N₃O

InChI: InChI=1S/C7H13N3O/c1-6-5-7(8)9-10(6)3-4-11-2/h5H,3-4H2,1-2H3,(H2,8,9)

InChI key: InChIKey=MVRLQPKRVPSIOL-UHFFFAOYSA-N

SMILES: C(COC)N1N=C(N)C=C1C

Synonyms:

• 1H-Pyrazol-3-amine, 1-(2-methoxyethyl)-5-methyl-
• 1-(2-Methoxyethyl)-5-methyl-1H-pyrazol-3-amine