
CAS 1240565-34-7
:1-(2-Ethylbutyl)-1H-pyrazol-4-amine
Description:
1-(2-Ethylbutyl)-1H-pyrazol-4-amine is a chemical compound characterized by its pyrazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of the 2-ethylbutyl group contributes to its hydrophobic properties, influencing its solubility and interaction with biological systems. This compound may exhibit various functional properties, including potential biological activity, making it of interest in pharmaceutical research. Its amine group can participate in hydrogen bonding, affecting its reactivity and interaction with other molecules. The specific arrangement of atoms and functional groups in 1-(2-Ethylbutyl)-1H-pyrazol-4-amine suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's stability, reactivity, and potential toxicity would need to be evaluated in detail for practical applications. As with many organic compounds, its physical properties, such as melting point, boiling point, and spectral characteristics, would be essential for understanding its behavior in various environments.
Formula:C9H17N3
InChI:InChI=1S/C9H17N3/c1-3-8(4-2)6-12-7-9(10)5-11-12/h5,7-8H,3-4,6,10H2,1-2H3
InChI key:InChIKey=YWTMJRDIVAPVKR-UHFFFAOYSA-N
SMILES:C(C(CC)CC)N1C=C(N)C=N1
Synonyms:- 1H-Pyrazol-4-amine, 1-(2-ethylbutyl)-
- 1-(2-Ethylbutyl)-1H-pyrazol-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.