CAS 1240568-17-5

4-Pyridinemethanamine, N-(1-methylpropyl)-, hydrochloride (1:2)

Description:

4-Pyridinemethanamine, N-(1-methylpropyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which contributes to its basicity and potential for forming hydrogen bonds. The presence of the N-(1-methylpropyl) group indicates that it has an alkyl substituent, which can influence its solubility and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it suitable for various applications in pharmaceutical formulations. This compound may exhibit biological activity, potentially acting as a ligand or modulator in biochemical pathways. Its properties, such as melting point, boiling point, and specific reactivity, would depend on the interactions of the pyridine moiety and the alkyl chain. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound's unique structure suggests potential utility in medicinal chemistry and related fields.

Formula: C₁₀H₁₆N₂·2ClH

InChI: InChI=1S/C10H16N2.2ClH/c1-3-9(2)12-8-10-4-6-11-7-5-10;;/h4-7,9,12H,3,8H2,1-2H3;2*1H

InChI key: InChIKey=DAIMEMMOGGKSRK-UHFFFAOYSA-N

SMILES: C(NC(CC)C)C=1C=CN=CC1.Cl

Synonyms:

• 4-Pyridinemethanamine, N-(1-methylpropyl)-, hydrochloride (1:2)

(butan-2-yl)[(pyridin-4-yl)methyl]amine dihydrochloride

CAS: 1240568-17-5

Formula: C₁₀H₁₈Cl₂N₂

Purity: 95.0%

Molecular weight: 237.17

Ref: 10-F523293