CAS 1240569-14-5

Benzenemethanamine, 3-fluoro-N-2-propen-1-yl-, hydrochloride (1:1)

Description:

Benzenemethanamine, 3-fluoro-N-2-propen-1-yl-, hydrochloride (1:1), also known by its CAS number 1240569-14-5, is a chemical compound characterized by its amine functional group and a substituted benzene ring. This compound features a fluoro substituent at the meta position of the benzene ring, which can influence its reactivity and biological activity. The presence of the propenyl group introduces a degree of unsaturation, potentially allowing for further chemical transformations. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceuticals. The hydrochloride form can enhance the compound's bioavailability and facilitate its use in medicinal chemistry. Its specific properties, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is used. Overall, this compound may have potential applications in drug development or as an intermediate in organic synthesis.

Formula: C₁₀H₁₂FN·ClH

InChI: InChI=1S/C10H12FN.ClH/c1-2-6-12-8-9-4-3-5-10(11)7-9;/h2-5,7,12H,1,6,8H2;1H

InChI key: InChIKey=KVQIWLKFRVRSNU-UHFFFAOYSA-N

SMILES: C(NCC=C)C1=CC(F)=CC=C1.Cl

Synonyms:

• Benzenemethanamine, 3-fluoro-N-2-propen-1-yl-, hydrochloride (1:1)

[(3-fluorophenyl)methyl](prop-2-en-1-yl)amine hydrochloride

CAS: 1240569-14-5

Formula: C₁₀H₁₃ClFN

Purity: 95.0%

Molecular weight: 201.67

Ref: 10-F523184