CymitQuimica logo

CAS 1240569-44-1

:

2-[2-(4-Amino-1H-pyrazol-1-yl)ethyl]-1H-isoindole-1,3(2H)-dione

Description:
2-[2-(4-Amino-1H-pyrazol-1-yl)ethyl]-1H-isoindole-1,3(2H)-dione, with the CAS number 1240569-44-1, is a chemical compound characterized by its complex structure, which includes an isoindole moiety and a pyrazole derivative. This compound typically exhibits properties such as solubility in polar solvents, which is common for many nitrogen-containing heterocycles. The presence of amino and carbonyl functional groups suggests potential for hydrogen bonding, influencing its reactivity and interactions with biological targets. It may exhibit pharmacological activity, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. The compound's molecular structure allows for various substitution patterns, which can affect its biological activity and stability. Additionally, its synthesis may involve multi-step organic reactions, highlighting the importance of understanding reaction mechanisms in the design of similar compounds. Overall, this substance represents a class of compounds that could have significant implications in drug discovery and development.
Formula:C13H12N4O2
InChI:InChI=1S/C13H12N4O2/c14-9-7-15-16(8-9)5-6-17-12(18)10-3-1-2-4-11(10)13(17)19/h1-4,7-8H,5-6,14H2
InChI key:InChIKey=NTKZHDHNQWFVBV-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CCN3N=CC(N)=C3)=CC=CC2
Synonyms:
  • 1H-Isoindole-1,3(2H)-dione, 2-[2-(4-amino-1H-pyrazol-1-yl)ethyl]-
  • 2-[2-(4-Amino-1H-pyrazol-1-yl)ethyl]-1H-isoindole-1,3(2H)-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.