CAS 1240569-45-2

4-(2-Methylpropyl)-N-2-propen-1-ylbenzenemethanamine

Description:

4-(2-Methylpropyl)-N-2-propen-1-ylbenzenemethanamine, identified by its CAS number 1240569-45-2, is an organic compound characterized by its complex structure, which includes an aromatic ring and multiple functional groups. This substance features a propyl side chain and an allyl group, contributing to its potential reactivity and interactions in various chemical environments. It is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar and non-polar solvents. The presence of the aromatic system may also impart stability and contribute to its electronic properties. Given its structural features, this compound may be of interest in fields such as medicinal chemistry or materials science, where its unique characteristics could be leveraged for specific applications. However, detailed studies on its physical and chemical properties, including boiling point, melting point, and reactivity, would be necessary to fully understand its behavior and potential uses in various chemical contexts.

Formula: C₁₄H₂₁N

InChI: InChI=1S/C14H21N/c1-4-9-15-11-14-7-5-13(6-8-14)10-12(2)3/h4-8,12,15H,1,9-11H2,2-3H3

InChI key: InChIKey=GVORGCOUCISLHI-UHFFFAOYSA-N

SMILES: C(C(C)C)C1=CC=C(CNCC=C)C=C1

Synonyms:

• 4-(2-Methylpropyl)-N-2-propen-1-ylbenzenemethanamine
• Benzenemethanamine, 4-(2-methylpropyl)-N-2-propen-1-yl-

{[4-(2-methylpropyl)phenyl]methyl}(prop-2-en-1-yl)amine

CAS: 1240569-45-2

Formula: C₁₄H₂₁N

Purity: 95.0%

Molecular weight: 203.329

Ref: 10-F523227