CAS 1240570-47-1

(3,4-Difluorophenyl)(2-methyl-1-piperazinyl)methanone

Description:

(3,4-Difluorophenyl)(2-methyl-1-piperazinyl)methanone is a chemical compound characterized by its unique structure, which includes a difluorophenyl group and a piperazine moiety. The presence of fluorine atoms in the phenyl ring enhances the compound's lipophilicity and may influence its biological activity. The piperazine ring, known for its versatility in medicinal chemistry, contributes to the compound's potential pharmacological properties, including interactions with various receptors. This compound is likely to exhibit moderate to high solubility in organic solvents, while its solubility in water may vary depending on the specific functional groups and their arrangement. The methanone functional group indicates the presence of a carbonyl group, which can participate in various chemical reactions, including nucleophilic attacks. Overall, this compound may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents, due to its structural features that suggest potential activity against specific biological targets. However, detailed studies would be necessary to fully elucidate its properties and applications.

Formula: C₁₂H₁₄F₂N₂O

InChI: InChI=1S/C12H14F2N2O/c1-8-7-15-4-5-16(8)12(17)9-2-3-10(13)11(14)6-9/h2-3,6,8,15H,4-5,7H2,1H3

InChI key: InChIKey=HHOREGRWBIKMBN-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=C(F)C=C1)N2C(C)CNCC2

Synonyms:

• Methanone, (3,4-difluorophenyl)(2-methyl-1-piperazinyl)-
• (3,4-Difluorophenyl)(2-methyl-1-piperazinyl)methanone