CAS 1240572-61-5

1-[(3,4-Dichlorophenyl)methyl]-2-methylpiperazine

Description:

1-[(3,4-Dichlorophenyl)methyl]-2-methylpiperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 3,4-dichlorophenyl group attached to the piperazine structure contributes to its potential biological activity, as halogenated phenyl groups often enhance lipophilicity and influence receptor interactions. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many piperazine derivatives. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric disorders. The compound's specific interactions with biological targets would depend on its conformation and the electronic effects of the substituents. Safety and handling precautions are essential, as with many synthetic organic compounds, due to potential toxicity or environmental impact. Further studies would be necessary to fully elucidate its pharmacological profile and therapeutic potential.

Formula: C₁₂H₁₆Cl₂N₂

InChI: InChI=1S/C12H16Cl2N2/c1-9-7-15-4-5-16(9)8-10-2-3-11(13)12(14)6-10/h2-3,6,9,15H,4-5,7-8H2,1H3

InChI key: InChIKey=VVGBFBOFYWEASV-UHFFFAOYSA-N

SMILES: C(C1=CC(Cl)=C(Cl)C=C1)N2C(C)CNCC2

Synonyms:

• 1-[(3,4-Dichlorophenyl)methyl]-2-methylpiperazine
• Piperazine, 1-[(3,4-dichlorophenyl)methyl]-2-methyl-