
CAS 1240572-94-4
:1-[[4-(Trifluoromethyl)phenyl]methyl]-1H-pyrazol-3-amine
Description:
1-[[4-(Trifluoromethyl)phenyl]methyl]-1H-pyrazol-3-amine is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a trifluoromethyl group (-CF3) on the phenyl ring significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. This compound features an amine functional group, which can participate in hydrogen bonding and may contribute to its reactivity and solubility in various solvents. The trifluoromethyl group is known for imparting unique electronic properties, making the compound of interest in medicinal chemistry and material science. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with specific biological activities. Additionally, the presence of multiple functional groups allows for further chemical modifications, which can be explored for enhancing efficacy or selectivity in targeted applications. Overall, this compound exemplifies the complexity and versatility of modern organic synthesis in creating molecules with tailored properties.
Formula:C11H10F3N3
InChI:InChI=1S/C11H10F3N3/c12-11(13,14)9-3-1-8(2-4-9)7-17-6-5-10(15)16-17/h1-6H,7H2,(H2,15,16)
InChI key:InChIKey=LQAIOMIPTUPSLP-UHFFFAOYSA-N
SMILES:C(C1=CC=C(C(F)(F)F)C=C1)N2C=CC(N)=N2
Synonyms:- 1H-Pyrazol-3-amine, 1-[[4-(trifluoromethyl)phenyl]methyl]-
- 1-[[4-(Trifluoromethyl)phenyl]methyl]-1H-pyrazol-3-amine
- 1-[[4-(Trifluoromethyl)phenyl]methyl]pyrazol-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.