CymitQuimica logo

CAS 1240573-27-6

:

2-[3-(4-Amino-1H-pyrazol-1-yl)propyl]-1H-isoindole-1,3(2H)-dione

Description:
2-[3-(4-Amino-1H-pyrazol-1-yl)propyl]-1H-isoindole-1,3(2H)-dione, identified by its CAS number 1240573-27-6, is a chemical compound that features a complex structure combining an isoindole moiety with a pyrazole derivative. This compound typically exhibits properties such as moderate solubility in polar solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the amino group suggests it may participate in hydrogen bonding, influencing its reactivity and interaction with biological targets. The isoindole structure contributes to its aromatic character, which can affect its stability and electronic properties. Additionally, the compound may exhibit specific pharmacological activities, potentially serving as a lead compound in drug development. Its synthesis and characterization would involve standard organic chemistry techniques, and its behavior in biological systems would require further investigation through pharmacological studies. Overall, this compound represents a class of heterocyclic compounds that are often explored for their therapeutic potential.
Formula:C14H14N4O2
InChI:InChI=1S/C14H14N4O2/c15-10-8-16-17(9-10)6-3-7-18-13(19)11-4-1-2-5-12(11)14(18)20/h1-2,4-5,8-9H,3,6-7,15H2
InChI key:InChIKey=VDKKAUZBAREALI-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CCCN3C=C(N)C=N3)=CC=CC2
Synonyms:
  • 2-[3-(4-Amino-1H-pyrazol-1-yl)propyl]-1H-isoindole-1,3(2H)-dione
  • 1H-Isoindole-1,3(2H)-dione, 2-[3-(4-amino-1H-pyrazol-1-yl)propyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.