CAS 1240578-15-7

Phenol, 2-bromo-6-methoxy-4-[(2-propen-1-ylamino)methyl]-, hydrochloride (1:1)

Description:

Phenol, 2-bromo-6-methoxy-4-[(2-propen-1-ylamino)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a phenolic ring substituted with a bromine atom, a methoxy group, and an amino side chain. The presence of the bromine atom enhances its reactivity, while the methoxy group contributes to its solubility and potential biological activity. The compound exists as a hydrochloride salt, indicating that it is protonated and more soluble in water, which is advantageous for various applications, including pharmaceutical formulations. Its structure suggests potential uses in medicinal chemistry, particularly in the development of compounds with antimicrobial or anticancer properties. The presence of the propenylamino group may also impart unique interactions with biological targets. As with many phenolic compounds, it may exhibit antioxidant properties, but specific biological activities would require further investigation. Safety and handling precautions are essential due to the potential toxicity associated with brominated compounds and amines.

Formula: C₁₁H₁₄BrNO₂·ClH

InChI: InChI=1S/C11H14BrNO2.ClH/c1-3-4-13-7-8-5-9(12)11(14)10(6-8)15-2;/h3,5-6,13-14H,1,4,7H2,2H3;1H

InChI key: InChIKey=KGHSIQGNZFFSRO-UHFFFAOYSA-N

SMILES: C(NCC=C)C1=CC(OC)=C(O)C(Br)=C1.Cl

Synonyms:

• Phenol, 2-bromo-6-methoxy-4-[(2-propen-1-ylamino)methyl]-, hydrochloride (1:1)