
CAS 1240581-71-8
:1-[[4-Chloro-3-(trifluoromethyl)phenyl]methyl]hexahydro-1H-1,4-diazepine
Description:
1-[[4-Chloro-3-(trifluoromethyl)phenyl]methyl]hexahydro-1H-1,4-diazepine is a chemical compound characterized by its complex structure, which includes a hexahydro-1H-1,4-diazepine ring fused with a phenyl group that is substituted with a chloro and trifluoromethyl group. The presence of the chloro group enhances the compound's reactivity and potential biological activity, while the trifluoromethyl group contributes to its lipophilicity and may influence its pharmacokinetic properties. This compound is likely to exhibit significant interactions with biological targets due to its structural features, making it of interest in medicinal chemistry and drug development. The hexahydro-1H-1,4-diazepine moiety suggests potential applications in the development of anxiolytic or sedative agents, as diazepines are commonly associated with such effects. Overall, the unique combination of functional groups and ring structures in this compound may lead to diverse applications in pharmaceuticals and agrochemicals, warranting further investigation into its properties and potential uses.
Formula:C13H16ClF3N2
InChI:InChI=1S/C13H16ClF3N2/c14-12-3-2-10(8-11(12)13(15,16)17)9-19-6-1-4-18-5-7-19/h2-3,8,18H,1,4-7,9H2
InChI key:InChIKey=WHTONSMIYGWKEO-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(CN2CCCNCC2)=CC=C1Cl
Synonyms:- 1-[[4-Chloro-3-(trifluoromethyl)phenyl]methyl]hexahydro-1H-1,4-diazepine
- 1H-1,4-Diazepine, 1-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]hexahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.