CAS 1240582-19-7

(2S)-4-[(1,1-Dimethylethoxy)carbonyl]-2-methyl-1-piperazineacetic acid

Description:

The chemical substance known as (2S)-4-[(1,1-Dimethylethoxy)carbonyl]-2-methyl-1-piperazineacetic acid, with the CAS number 1240582-19-7, is characterized by its specific stereochemistry and functional groups. It features a piperazine ring, which is a six-membered cyclic amine, contributing to its potential biological activity. The presence of a carboxylic acid group indicates that it can participate in acid-base reactions, while the dimethylethoxycarbonyl group suggests that it may serve as a protecting group in synthetic applications. The compound's chirality, denoted by the (2S) configuration, implies that it exists as one specific enantiomer, which can significantly influence its pharmacological properties. Additionally, the presence of a methyl group enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways.

Formula: C₁₂H₂₂N₂O₄

InChI: InChI=1S/C12H22N2O4/c1-9-7-14(11(17)18-12(2,3)4)6-5-13(9)8-10(15)16/h9H,5-8H2,1-4H3,(H,15,16)/t9-/m0/s1

InChI key: InChIKey=DTPBLKDYIFKPAT-VIFPVBQESA-N

SMILES: C(OC(C)(C)C)(=O)N1C[C@H](C)N(CC(O)=O)CC1

Synonyms:

• 1-Piperazineacetic acid, 4-[(1,1-dimethylethoxy)carbonyl]-2-methyl-, (2S)-
• (2S)-4-[(1,1-Dimethylethoxy)carbonyl]-2-methyl-1-piperazineacetic acid