CAS 1240594-22-2

Pyrimidine, 5-bromo-2-(4-pyridinyl)-

Description:

Pyrimidine, 5-bromo-2-(4-pyridinyl)- is a heterocyclic organic compound characterized by its pyrimidine ring structure, which consists of a six-membered ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromine atom at the 5-position and a 4-pyridinyl group at the 2-position introduces significant functional diversity, making it a compound of interest in medicinal chemistry and material science. This compound exhibits properties typical of halogenated pyrimidines, including potential biological activity, such as antimicrobial or anticancer effects, due to the presence of the bromine substituent and the pyridine moiety. Its solubility and reactivity can vary based on the solvent and conditions, and it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound's molecular structure allows for interactions with biological targets, making it a candidate for further research in drug development and synthesis of novel materials.

Formula: C₉H₆BrN₃

InChI: InChI=1S/C9H6BrN3/c10-8-5-12-9(13-6-8)7-1-3-11-4-2-7/h1-6H

InChI key: InChIKey=HRIIPRDJCQAMMP-UHFFFAOYSA-N

SMILES: BrC=1C=NC(=NC1)C=2C=CN=CC2

Synonyms:

• Pyrimidine, 5-bromo-2-(4-pyridinyl)-

5-Bromo-2-(pyridin-4-yl)pyrimidine

CAS: 1240594-22-2

Versatile small molecule scaffold

Formula: C₉H₆BrN₃

Purity: Min. 95%

Molecular weight: 236.07 g/mol

Ref: 3D-QZB59422