CAS 1240594-56-2

5-Formyl-2-pyrimidinecarboxylic acid

Description:

5-Formyl-2-pyrimidinecarboxylic acid is a heterocyclic organic compound characterized by a pyrimidine ring substituted with both a formyl group and a carboxylic acid group. This compound features a pyrimidine structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of the formyl group (-CHO) at the 5-position and the carboxylic acid group (-COOH) at the 2-position contributes to its reactivity and potential applications in organic synthesis. The compound is likely to exhibit properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can influence its solubility and interaction with other molecules. Additionally, the presence of the nitrogen atoms in the pyrimidine ring may impart basicity and contribute to the compound's biological activity. Overall, 5-Formyl-2-pyrimidinecarboxylic acid is of interest in medicinal chemistry and may serve as a building block for the synthesis of various pharmaceuticals and agrochemicals.

Formula: C₆H₄N₂O₃

InChI: InChI=1S/C6H4N2O3/c9-3-4-1-7-5(6(10)11)8-2-4/h1-3H,(H,10,11)

InChI key: InChIKey=BGKJMBHZTIHAAJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N=CC(C=O)=CN1

Synonyms:

• 5-Formyl-2-pyrimidinecarboxylic acid
• 2-Pyrimidinecarboxylic acid, 5-formyl-