CymitQuimica logo

CAS 1240595-21-4

:

6-Chloro-2-(3-pyridinyl)-4-pyrimidinecarboxylic acid

Description:
6-Chloro-2-(3-pyridinyl)-4-pyrimidinecarboxylic acid is a chemical compound characterized by its pyrimidine and pyridine moieties, which contribute to its biological activity and potential applications in medicinal chemistry. The presence of a chlorine atom at the 6-position of the pyrimidine ring enhances its reactivity and may influence its interaction with biological targets. This compound typically exhibits acidic properties due to the carboxylic acid functional group, which can participate in hydrogen bonding and ionic interactions. Its structural features suggest potential use in the development of pharmaceuticals, particularly in targeting specific enzymes or receptors. The compound's solubility and stability can vary depending on the pH and solvent conditions, which are important considerations for its application in drug formulation. Additionally, the presence of heteroatoms like nitrogen in the pyridine and pyrimidine rings may contribute to its pharmacokinetic properties, such as absorption and distribution in biological systems. Overall, 6-Chloro-2-(3-pyridinyl)-4-pyrimidinecarboxylic acid represents a class of compounds with significant potential in drug discovery and development.
Formula:C10H6ClN3O2
InChI:InChI=1S/C10H6ClN3O2/c11-8-4-7(10(15)16)13-9(14-8)6-2-1-3-12-5-6/h1-5H,(H,15,16)
InChI key:InChIKey=UOTYGCNGQHVJHU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=NC(=NC(Cl)=C1)C=2C=CC=NC2
Synonyms:
  • 6-Chloro-2-(3-pyridinyl)-4-pyrimidinecarboxylic acid
  • 4-Pyrimidinecarboxylic acid, 6-chloro-2-(3-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.