CAS 1240598-08-6

5-Bromo-4-chloro-6-(trifluoromethyl)-2-pyrimidinamine

Description:

5-Bromo-4-chloro-6-(trifluoromethyl)-2-pyrimidinamine is a heterocyclic organic compound characterized by its pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromine atom at position 5 and a chlorine atom at position 4 contributes to its reactivity and potential applications in medicinal chemistry. The trifluoromethyl group at position 6 enhances the compound's lipophilicity and metabolic stability, making it of interest in drug design and development. This compound may exhibit biological activity, potentially serving as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the presence of multiple halogen substituents may influence its solubility and interaction with biological targets. Overall, 5-Bromo-4-chloro-6-(trifluoromethyl)-2-pyrimidinamine is a compound of interest in the fields of organic synthesis and medicinal chemistry.

Formula: C₅H₂BrClF₃N₃

InChI: InChI=1S/C5H2BrClF3N3/c6-1-2(5(8,9)10)12-4(11)13-3(1)7/h(H2,11,12,13)

InChI key: InChIKey=ICGLIQCZSQPZFY-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C(Br)=C(Cl)N=C(N)N1

Synonyms:

• 2-Pyrimidinamine, 5-bromo-4-chloro-6-(trifluoromethyl)-
• 5-Bromo-4-chloro-6-(trifluoromethyl)-2-pyrimidinamine

5-Bromo-4-chloro-6-(trifluoromethyl)pyrimidin-2-amine

CAS: 1240598-08-6

Formula: C₅H₂BrClF₃N₃

Molecular weight: 276.4417

Ref: IN-DA000LH3