CymitQuimica logo

CAS 1240605-18-8

:

1-[2-(3-Thienyl)ethyl]piperazine

Description:
1-[2-(3-Thienyl)ethyl]piperazine is a chemical compound characterized by its unique structure, which includes a piperazine ring and a thienyl group. The thienyl moiety, derived from thiophene, contributes to the compound's aromatic properties and potential biological activity. This substance is typically classified as an organic compound and may exhibit various pharmacological effects due to its ability to interact with neurotransmitter systems. Its molecular structure suggests it could be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. The presence of the piperazine ring often indicates potential for central nervous system activity, making it a candidate for research in neuropharmacology. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the piperazine and thienyl groups, which are critical for its application in drug design and synthesis. Overall, 1-[2-(3-Thienyl)ethyl]piperazine represents a compound with intriguing properties that warrant further investigation in both synthetic and medicinal chemistry contexts.
Formula:C10H16N2S
InChI:InChI=1S/C10H16N2S/c1(10-2-8-13-9-10)5-12-6-3-11-4-7-12/h2,8-9,11H,1,3-7H2
InChI key:InChIKey=ZAEKCESMRDKXJD-UHFFFAOYSA-N
SMILES:C(CC=1C=CSC1)N2CCNCC2
Synonyms:
  • Piperazine, 1-[2-(3-thienyl)ethyl]-
  • 1-[2-(3-Thienyl)ethyl]piperazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.