CymitQuimica logo

CAS 1240612-11-6

:

Oxazole, 4-(chloromethyl)-5-methyl-

Description:
Oxazole, 4-(chloromethyl)-5-methyl- is a heterocyclic organic compound characterized by the presence of an oxazole ring, which consists of a five-membered ring containing both nitrogen and oxygen atoms. The specific structure of this compound includes a chloromethyl group at the 4-position and a methyl group at the 5-position of the oxazole ring. This configuration contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the chloromethyl group makes it a useful intermediate for further chemical modifications, allowing for the introduction of various functional groups. Additionally, the methyl substitution can influence the compound's physical properties, such as solubility and boiling point. Oxazole derivatives are known for their biological activities, including antimicrobial and antifungal properties, making them of interest in pharmaceutical research. As with many chlorinated compounds, appropriate safety measures should be taken when handling this substance due to potential toxicity and environmental concerns.
Formula:C5H6ClNO
InChI:InChI=1S/C5H6ClNO/c1-4-5(2-6)7-3-8-4/h3H,2H2,1H3
InChI key:InChIKey=AIDJHZCWQZOCHV-UHFFFAOYSA-N
SMILES:C(Cl)C1=C(C)OC=N1
Synonyms:
  • Oxazole, 4-(chloromethyl)-5-methyl-
  • 4-(Chloromethyl)-5-methyloxazole
Found 3 products.