CymitQuimica logo

CAS 1240617-99-5

:

2-(1-Ethynylcyclopropyl)pyridine

Description:
2-(1-Ethynylcyclopropyl)pyridine is a chemical compound characterized by its unique structure, which includes a pyridine ring and an ethynyl-substituted cyclopropyl group. The presence of the pyridine moiety imparts basic properties to the compound, making it a potential ligand in coordination chemistry. The ethynyl group contributes to its reactivity, allowing for various chemical transformations, such as coupling reactions. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the ability of pyridine derivatives to interact with biological targets. Additionally, the cyclopropyl ring can influence the compound's conformational flexibility and steric properties, which are crucial in drug design. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during its use in laboratory or industrial settings.
Formula:C10H9N
InChI:InChI=1S/C10H9N/c1-2-10(6-7-10)9-5-3-4-8-11-9/h1,3-5,8H,6-7H2
InChI key:InChIKey=DHBLETURPKYCQF-UHFFFAOYSA-N
SMILES:C(#C)C1(CC1)C2=CC=CC=N2
Synonyms:
  • 2-(1-Ethynylcyclopropyl)pyridine
  • Pyridine, 2-(1-ethynylcyclopropyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.