CAS 1240621-87-7
:2-bromopyrimidin-5-ol
Description:
2-Bromopyrimidin-5-ol is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a bromine atom at the second position and a hydroxyl group at the fifth position. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydroxyl group. The bromine substituent introduces notable reactivity, making it a useful intermediate in various organic synthesis reactions, including nucleophilic substitutions and coupling reactions. The presence of the hydroxyl group enhances its potential for hydrogen bonding, influencing its physical properties and reactivity. 2-Bromopyrimidin-5-ol can be utilized in the synthesis of pharmaceuticals and agrochemicals, as well as in the development of biologically active compounds. Its molecular structure allows for diverse applications in medicinal chemistry, particularly in the design of compounds targeting specific biological pathways. As with many brominated compounds, care should be taken regarding its handling and disposal due to potential environmental and health impacts.
Formula:C4H3N2OBr
InChI:InChI=1S/C4H3BrN2O/c5-4-6-1-3(8)2-7-4/h1-2,8H
SMILES:c1c(cnc(Br)n1)O
Synonyms:- 2-Bromo-5-hydroxypyrimidine
- 2-Bromo-5-Pyrimidinol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Pyrimidinol, 2-bromo-
CAS:Formula:C4H3BrN2OPurity:95%Color and Shape:SolidMolecular weight:174.98342-Bromopyrimidin-5-ol
CAS:2-Bromopyrimidin-5-ol is a reactive chemical that can be used as an additive in plastics. It is also mesomorphic and polarizing, which means it can change from being liquid to solid at different temperatures. This chemical has been shown to exhibit magnetic resonance spectroscopy (MRS) and microscopy properties, as well as dichroic transitions. The 2-Bromopyrimidin-5-ol can be photopolymerized with UV irradiation, making it useful for optical applications.Formula:C4H3BrN2OPurity:Min. 95%Molecular weight:174.99 g/mol



