
CAS 124066-33-7
:2-[(2-Thienylcarbonyl)amino]ethanesulfonic acid
Description:
2-[(2-Thienylcarbonyl)amino]ethanesulfonic acid, with the CAS number 124066-33-7, is a chemical compound characterized by its unique structure that includes a thienyl group, an amine, and a sulfonic acid functional group. This compound is typically a white to off-white solid and is soluble in water due to the presence of the sulfonic acid group, which enhances its ionic character. The thienyl moiety contributes to its aromatic properties, potentially influencing its reactivity and interactions in biological systems. The presence of the sulfonic acid group suggests that it may exhibit acidic behavior, making it useful in various biochemical applications, including as a buffer or in the synthesis of other compounds. Additionally, the compound may have specific applications in pharmaceuticals or as a reagent in organic synthesis, owing to its functional groups that can participate in various chemical reactions. Overall, its unique combination of functional groups makes it a compound of interest in both research and industrial applications.
Formula:C7H9NO4S2
InChI:InChI=1S/C7H9NO4S2/c9-7(6-2-1-4-13-6)8-3-5-14(10,11)12/h1-2,4H,3,5H2,(H,8,9)(H,10,11,12)
InChI key:InChIKey=JJXDGYJCYKWEAI-UHFFFAOYSA-N
SMILES:C(NCCS(=O)(=O)O)(=O)C1=CC=CS1
Synonyms:- 2-[(2-Thienylcarbonyl)amino]ethanesulfonic acid
- 2-(Thiophene-2-carbonylamino)ethanesulfonic acid
- Taurosteine
- Ethanesulfonic acid, 2-[(2-thienylcarbonyl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.