CymitQuimica logo

CAS 124066-40-6

:

BAL-ARI8

Description:
BAL-ARI8, identified by its CAS number 124066-40-6, is a chemical compound that belongs to a class of substances known for their applications in various fields, including medicinal chemistry and materials science. While specific characteristics such as molecular weight, boiling point, and solubility may vary, compounds in this category typically exhibit properties that make them useful as ligands or in drug formulation. They may possess functional groups that allow for interactions with biological targets or facilitate complexation with metal ions. Additionally, BAL-ARI8 may demonstrate stability under certain conditions, making it suitable for storage and handling in laboratory settings. Its synthesis often involves multi-step organic reactions, and its efficacy in applications can be influenced by structural modifications. As with any chemical substance, safety data sheets should be consulted for handling precautions and potential hazards associated with BAL-ARI8. Further research and characterization are essential to fully understand its properties and potential uses in various applications.
Formula:C16H12FNO6S
InChI:InChI=1/C16H12FNO6S/c1-18(8-15(19)20)25(22,23)10-3-5-14-12(7-10)16(21)11-6-9(17)2-4-13(11)24-14/h2-7H,8H2,1H3,(H,19,20)
SMILES:CN(CC(=O)O)S(=O)(=O)c1ccc2c(c1)c(=O)c1cc(ccc1o2)F
Synonyms:
  • 7-Fluoro-2-(N-methyl-N-carboxymethyl)sulfamoyl xanthone
  • N-((7-Fluoro-9-oxo-9H-xanthen-2-yl)sulfonyl)-N-methylglycine
  • Glycine, N-((7-fluoro-9-oxo-9H-xanthen-2-yl)sulfonyl)-N-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.