CAS 124070-15-1

10,11-Dihydro-5H-dibenzo[a,d]cyclohepten-5,10-imine-5-carboxamide

Description:

10,11-Dihydro-5H-dibenzo[a,d]cyclohepten-5,10-imine-5-carboxamide is a chemical compound characterized by its complex bicyclic structure, which includes a fused ring system typical of dibenzo compounds. This substance features an imine functional group and a carboxamide group, contributing to its potential reactivity and biological activity. The presence of these functional groups suggests that it may participate in various chemical reactions, such as nucleophilic attacks or hydrogen bonding. The compound's unique structure may also influence its solubility, stability, and interaction with biological targets, making it of interest in medicinal chemistry and pharmacology. Additionally, the compound's molecular weight, melting point, and spectral properties (such as NMR and IR) would provide further insights into its characteristics and potential applications. As with many organic compounds, safety data and handling precautions are essential for laboratory work involving this substance, particularly due to its complex structure and potential biological effects.

Formula: C₁₆H₁₄N₂O

InChI: InChI=1S/C16H14N2O/c17-15(19)16-12-7-3-1-5-10(12)9-14(18-16)11-6-2-4-8-13(11)16/h1-8,14,18H,9H2,(H2,17,19)

InChI key: InChIKey=IFLVGRRVGPXYON-UHFFFAOYSA-N

SMILES: C(N)(=O)C12C=3C(C(N1)CC=4C2=CC=CC4)=CC=CC3

Synonyms:

• 10,11-Dihydro-5H-dibenzo[a,d]cyclohepten-5,10-imine-5-carboxamide
• 5-(Aminocarbonyl)-10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5,10-imine
• 5H-Dibenzo[a,d]cyclohepten-5,10-imine-5-carboxamide, 10,11-dihydro-, (±)-
• ADCI
• 5H-Dibenzo[a,d]cyclohepten-5,10-imine-5-carboxamide, 10,11-dihydro-

ADCI

CAS: 124070-15-1

ADCI inhibits voltage-activated sodium and NMDA channels; boosts dopamine metabolism in prefrontal cortex and nucleus accumbens.

Formula: C₁₆H₁₄N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 250.3

Ref: TM-T26564