![5-Chloro-1H-pyrazolo[3,4-b]pyridine](https://static.cymitquimica.com/cas-image/267405-5-chloro-1h-pyrazolo-34-b-pyridine.png)
CAS 1240725-66-9: 5-Chloro-1H-pyrazolo[3,4-b]pyridine
Description:5-Chloro-1H-pyrazolo[3,4-b]pyridine is a heterocyclic compound characterized by its fused pyrazole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 5-position of the pyrazole ring enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The molecular structure allows for various functionalization possibilities, making it a versatile intermediate in organic synthesis. Additionally, its stability under standard laboratory conditions and moderate toxicity profile are important considerations for handling and application in research. Overall, 5-Chloro-1H-pyrazolo[3,4-b]pyridine is a significant compound in the field of organic and medicinal chemistry, with ongoing research into its properties and applications.
Formula:C6H4ClN3
InChI:InChI=1S/C6H4ClN3/c7-5-1-4-2-9-10-6(4)8-3-5/h1-3H,(H,8,9,10)
InChI key:InChIKey=KTMQQKMLYDWDKL-UHFFFAOYSA-N
SMILES:ClC=1C=NC=2NN=CC2C1
- Synonyms:
- 5-Chloro-1H-pyrazolo[3,4-b]pyridine
- 1H-Pyrazolo[3,4-b]pyridine, 5-chloro-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 1H-Pyrazolo[3,4-b]pyridine, 5-chloro- REF: IN-DA000LJ8CAS: 1240725-66-9 | 97% | 41.00 €~782.00 € | Wed 26 Mar 25 |
 | 5-Chloro-1H-pyrazolo[3,4-b]pyridine REF: 54-OR303341CAS: 1240725-66-9 | 0.97 | 32.00 €~2,793.00 € | Wed 02 Apr 25 |
 | 5-Chloro-1H-pyrazolo[3,4-b]pyridine REF: TR-B418725CAS: 1240725-66-9 | - - - | 2,320.00 € | Tue 06 May 25 |
 | 5-Chloro-1H-pyrazolo[3,4-b]pyridine REF: 10-F050766CAS: 1240725-66-9 | 97% | - - - | Discontinued product |
 | 5-Chloro-1H-pyrazolo[3,4-b]pyridine REF: 3D-QZB72566CAS: 1240725-66-9 | Min. 95% | - - - | Discontinued product |
![1H-Pyrazolo[3,4-b]pyridine, 5-chloro-](https://static.cymitquimica.com/products/IN/thumb/DA000LJ8.jpg)
1H-Pyrazolo[3,4-b]pyridine, 5-chloro-
Ref: IN-DA000LJ8
| 1g | 138.00 € | ||
| 5g | 612.00 € | ||
| 25mg | 41.00 € | ||
| 100mg | 42.00 € | ||
| 250mg | 56.00 € |
![5-Chloro-1H-pyrazolo[3,4-b]pyridine](https://static.cymitquimica.com/products/54/thumb/OR303341.jpg)
Ref: 54-OR303341
| 1g | 144.00 € | ||
| 5g | 617.00 € | ||
| 25g | 2,793.00 € | ||
| 100mg | 32.00 € |
![5-Chloro-1H-pyrazolo[3,4-b]pyridine](https://static.cymitquimica.com/products/TR/thumb/B418725.jpg)
5-Chloro-1H-pyrazolo[3,4-b]pyridine
Controlled ProductRef: TR-B418725
| 1g | 2,320.00 € |
![5-Chloro-1H-pyrazolo[3,4-b]pyridine](https://static.cymitquimica.com/products/10/thumb/F050766.jpg)
5-Chloro-1H-pyrazolo[3,4-b]pyridine
Ref: 10-F050766
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information |
![5-Chloro-1H-pyrazolo[3,4-b]pyridine](https://static.cymitquimica.com/products/3D/thumb/QZB72566.jpg)
5-Chloro-1H-pyrazolo[3,4-b]pyridine
Ref: 3D-QZB72566
| 1g | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information | |
| 2500mg | Discontinued | Request information |
