CAS 124076-67-1
:S-(2,2-dichloro-1,1-difluoroethyl)cysteine
Description:
S-(2,2-Dichloro-1,1-difluoroethyl)cysteine is a synthetic compound that belongs to the class of cysteine derivatives, characterized by the presence of a cysteine amino acid backbone modified with a dichloro-difluoroethyl group. This modification imparts unique chemical properties, including increased lipophilicity and potential reactivity due to the presence of halogen atoms. The compound is likely to exhibit polar characteristics due to the thiol (-SH) group of cysteine, which can participate in various chemical reactions, including nucleophilic attacks and disulfide bond formation. Additionally, the halogen substituents can influence the compound's biological activity, potentially affecting its interaction with biological macromolecules. S-(2,2-Dichloro-1,1-difluoroethyl)cysteine may be of interest in medicinal chemistry and biochemistry, particularly in studies related to drug design and the development of therapeutic agents. However, specific safety and handling guidelines should be followed due to the presence of halogenated groups, which may pose environmental and health risks.
Formula:C5H7Cl2F2NO2S
InChI:InChI=1/C5H7Cl2F2NO2S/c6-4(7)5(8,9)13-1-2(10)3(11)12/h2,4H,1,10H2,(H,11,12)/t2-/m0/s1
SMILES:C([C@@H](C(=O)O)N)SC(C(Cl)Cl)(F)F
Synonyms:- Ccris 6663
- S-(2,2-Dichloro-1,1-difluoroethyl)-L-cysteine
- S-(2,2-Dichloro-1,1-difluoroethyl)cysteine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
