CymitQuimica logo

CAS 124082-20-8

:

Benzenepropanoic acid, β-amino-3,4-dichloro-, methyl ester, hydrochloride (1:1)

Description:
Benzenepropanoic acid, β-amino-3,4-dichloro-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a benzene ring, a propanoic acid moiety, and a β-amino group with dichloro substitutions. The presence of the methyl ester indicates that the carboxylic acid group is esterified with a methyl group, enhancing its lipophilicity and potentially influencing its biological activity. The hydrochloride form suggests that the compound is a salt, which can improve its solubility in aqueous solutions, making it more suitable for pharmaceutical applications. This compound may exhibit various biological activities due to its amino and halogenated substituents, which can interact with biological targets. Its specific properties, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied. As with many compounds containing halogens and amino groups, it may also be of interest in medicinal chemistry for its potential therapeutic applications.
Formula:C10H11Cl2NO2·ClH
InChI:InChI=1S/C10H11Cl2NO2.ClH/c1-15-10(14)5-9(13)6-2-3-7(11)8(12)4-6;/h2-4,9H,5,13H2,1H3;1H
InChI key:InChIKey=DJSSFGWNYRSXFO-UHFFFAOYSA-N
SMILES:C(CC(OC)=O)(N)C1=CC(Cl)=C(Cl)C=C1.Cl
Synonyms:
  • Benzenepropanoic acid, β-amino-3,4-dichloro-, methyl ester, hydrochloride (1:1)
  • Benzenepropanoic acid, β-amino-3,4-dichloro-, methyl ester, hydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.