CymitQuimica logo

CAS 124083-17-6

:

8-(4-chlorophenoxy)-2-methylideneoctanoic acid

Description:
8-(4-Chlorophenoxy)-2-methylideneoctanoic acid, identified by its CAS number 124083-17-6, is a chemical compound that belongs to the class of fatty acids and derivatives. This substance features a long hydrocarbon chain, which contributes to its lipophilic properties, making it soluble in organic solvents but less so in water. The presence of the 4-chlorophenoxy group introduces aromatic characteristics, which can influence its reactivity and interaction with biological systems. The methylidene group indicates the presence of a double bond, which can affect the compound's stability and reactivity, particularly in chemical reactions such as polymerization or oxidation. This compound may exhibit biological activity, potentially serving as a pharmaceutical intermediate or a bioactive agent, although specific biological properties would depend on further studies. Overall, its unique structure suggests potential applications in various fields, including medicinal chemistry and materials science, but detailed studies would be necessary to fully elucidate its properties and uses.
Formula:C15H19ClO3
InChI:InChI=1/C15H19ClO3/c1-12(15(17)18)6-4-2-3-5-11-19-14-9-7-13(16)8-10-14/h7-10H,1-6,11H2,(H,17,18)
SMILES:C=C(CCCCCCOc1ccc(cc1)Cl)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.