CAS 124083-22-3

Oxiranecarboxylic acid, 2-[6-(4-chlorophenoxy)hexyl]-, (S)-

Description:

Oxiranecarboxylic acid, 2-[6-(4-chlorophenoxy)hexyl]-, (S)-, with CAS number 124083-22-3, is a chiral compound characterized by its oxirane (epoxide) functional group and a carboxylic acid moiety. This compound features a hexyl chain substituted with a 4-chlorophenoxy group, which contributes to its hydrophobic properties and potential biological activity. The presence of the oxirane ring suggests that it may participate in various chemical reactions, including ring-opening reactions, which can lead to the formation of more complex structures. The (S)- designation indicates that the molecule has a specific stereochemistry, which can influence its reactivity and interactions with biological systems. Such compounds are often of interest in medicinal chemistry and materials science due to their unique structural features and potential applications. Additionally, the chlorophenoxy group may impart specific pharmacological properties, making this compound a candidate for further research in drug development or agrochemical applications.

Formula: C₁₅H₁₉ClO₄

InChI: InChI=1S/C15H19ClO4/c16-12-5-7-13(8-6-12)19-10-4-2-1-3-9-15(11-20-15)14(17)18/h5-8H,1-4,9-11H2,(H,17,18)/t15-/m0/s1

InChI key: InChIKey=NWSIRTXVYBEURF-HNNXBMFYSA-N

SMILES: C(CCCCCOC1=CC=C(Cl)C=C1)[C@@]2(C(O)=O)CO2

Synonyms:

• Oxiranecarboxylic acid, 2-[6-(4-chlorophenoxy)hexyl]-, (S)-

Oxiranecarboxylic acid, 2-[6-(4-chlorophenoxy)hexyl]-, (S)- (9CI)

CAS: 124083-22-3

Formula: C₁₅H₁₉ClO₄

Molecular weight: 298.762

Ref: IN-DA000LK3