CAS 1240832-76-1

Methyl 4,5-dichloro-6-methyl-3-pyridinecarboxylate

Description:

Methyl 4,5-dichloro-6-methyl-3-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. This compound features two chlorine substituents at the 4 and 5 positions, and a methyl group at the 6 position of the pyridine ring, along with a carboxylate ester functional group. The presence of chlorine atoms contributes to its potential reactivity and influences its physical properties, such as solubility and boiling point. As an ester, it is likely to exhibit moderate polarity, making it soluble in organic solvents while being less soluble in water. The compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. Additionally, its synthesis and handling require careful consideration of safety protocols due to the presence of halogenated compounds, which can pose environmental and health risks. Overall, Methyl 4,5-dichloro-6-methyl-3-pyridinecarboxylate is a structurally complex molecule with diverse applications in chemical research.

Formula: C₈H₇Cl₂NO₂

InChI: InChI=1S/C8H7Cl2NO2/c1-4-6(9)7(10)5(3-11-4)8(12)13-2/h3H,1-2H3

InChI key: InChIKey=XCXCPXNSOKPNBO-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C(Cl)=C(Cl)C(C)=NC1

Synonyms:

• Methyl 4,5-dichloro-6-methyl-3-pyridinecarboxylate
• 3-Pyridinecarboxylic acid, 4,5-dichloro-6-methyl-, methyl ester
• Methyl 4,5-dichloro-6-methylnicotinate