CAS 1240948-77-9

5-(2-Fluorophenyl)-1H-Pyrrole-3-Carbonitrile

Description:

5-(2-Fluorophenyl)-1H-Pyrrole-3-Carbonitrile is an organic compound characterized by its pyrrole ring, which is a five-membered aromatic heterocycle containing nitrogen. The presence of a 2-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, influencing the compound's electronic properties and potentially its reactivity. The carbonitrile functional group (-C≡N) attached to the pyrrole ring contributes to the compound's polarity and can participate in various chemical reactions, such as nucleophilic additions or cycloadditions. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. Additionally, the presence of fluorine can enhance lipophilicity and metabolic stability, which are desirable traits in pharmaceutical compounds. Overall, 5-(2-Fluorophenyl)-1H-Pyrrole-3-Carbonitrile represents a versatile structure with potential implications in various fields of chemistry and pharmacology.

Formula: C₁₁H₇FN₂

InChI: InChI=1S/C11H7FN2/c12-10-4-2-1-3-9(10)11-5-8(6-13)7-14-11/h1-5,7,14H

InChI key: InChIKey=ZDEFHFJZEDEKJO-UHFFFAOYSA-N

SMILES: FC1=C(C2=CC(C#N)=CN2)C=CC=C1

1H-Pyrrole-3-carbonitrile, 5-(2-fluorophenyl)-

CAS: 1240948-77-9

Formula: C₁₁H₇FN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 186.1851

Ref: IN-DA000LJV

5-(2-Fluorophenyl)-1H-pyrrole-3-carbonitrile

CAS: 1240948-77-9

5-(2-Fluorophenyl)-1H-pyrrole-3-carbonitrile

Purity: 99%

Molecular weight: 186.19g/mol

Ref: 54-PC201087

Vonoprazan Impurity 74

CAS: 1240948-77-9

Formula: C₁₁H₇FN₂

Molecular weight: 186.19

Ref: 4Z-V-051084

5-(2-FLUOROPHENYL)-1H-PYRROLE-3-CARBONITRILE

CAS: 1240948-77-9

Formula: C₁₁H₇FN₂

Purity: 98%

Molecular weight: 186.189

Ref: 10-F466768

Vonoprazan Impurity 48

CAS: 1240948-77-9

Formula: C₁₁H₇FN₂

Molecular weight: 186.19

Ref: ST-EA-CP-V14055

5-(2-Fluorophenyl)-1H-pyrrole-3-carbonitrile

CAS: 1240948-77-9

Vonoprazan is a prodrug that is hydrolyzed in vivo to vonoprazan fumarate, its active form. Vonoprazan fumarate inhibits gastric acid secretion by blocking the H/K-ATPase and proton pump, thereby inhibiting the final step of gastric acid production. It has been shown to have an effect on pH in the stomach and duodenum for up to 4 hours following administration. Vonoprazan also inhibits the formation of salt from carbonic acid, which may be due to its ability to inhibit chloride secretion by blocking the cystic fibrosis transmembrane regulator (CFTR).

Formula: C₁₁H₇FN₂

Purity: Min. 95%

Color and Shape: Slightly Yellow Powder

Molecular weight: 186.19 g/mol

Ref: 3D-FF88901

5-(2-Fluorophenyl)-1H-pyrrole-3-carbonitrile

CAS: 1240948-77-9

5-(2-Fluorophenyl)-1H-pyrrole-3-carbonitrile is a useful organic compound for research related to life sciences. The catalog number is T66771 and the CAS number is 1240948-77-9.

Formula: C₁₁H₇FN₂

Color and Shape: Solid

Molecular weight: 186.189

Ref: TM-T66771