CymitQuimica logo

CAS 1241675-04-6

:

5′-Bromo[1(2H),2′-bipyridin]-2-one

Description:
5′-Bromo[1(2H),2′-bipyridin]-2-one is a chemical compound characterized by its unique structural features, which include a bipyridine framework and a bromine substituent. This compound typically exhibits a heterocyclic structure, where the bipyridine moiety consists of two pyridine rings connected by a carbon-carbon bond. The presence of the bromine atom at the 5′ position enhances its reactivity and can influence its electronic properties, making it a valuable intermediate in organic synthesis and medicinal chemistry. The carbonyl group (ketone) at the 2-position contributes to its potential as a ligand in coordination chemistry, allowing it to form complexes with various metal ions. Additionally, this compound may exhibit biological activity, which can be explored in pharmaceutical applications. Its solubility, stability, and reactivity can vary depending on the solvent and conditions, making it important to consider these factors in practical applications. Overall, 5′-Bromo[1(2H),2′-bipyridin]-2-one is a versatile compound with significant implications in chemical research and development.
Formula:C10H7BrN2O
InChI:InChI=1S/C10H7BrN2O/c11-8-4-5-9(12-7-8)13-6-2-1-3-10(13)14/h1-7H
InChI key:InChIKey=WIOXXTHZFXKJBL-UHFFFAOYSA-N
SMILES:O=C1N(C2=CC=C(Br)C=N2)C=CC=C1
Synonyms:
  • [1(2H),2′-Bipyridin]-2-one, 5′-bromo-
  • 5′-Bromo[1(2H),2′-bipyridin]-2-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.