CAS 1241675-79-5

N-Ethyl-N′-(trans-4-hydroxycyclohexyl)urea

Description:

N-Ethyl-N′-(trans-4-hydroxycyclohexyl)urea is a chemical compound characterized by its urea functional group, which is central to its structure. This compound features an ethyl group attached to one nitrogen atom of the urea, while the other nitrogen is bonded to a trans-4-hydroxycyclohexyl group. The presence of the hydroxyl group contributes to its potential solubility in polar solvents and may influence its reactivity and interactions with biological systems. The trans configuration of the cyclohexyl moiety suggests a specific spatial arrangement that can affect the compound's steric properties and overall conformation. N-Ethyl-N′-(trans-4-hydroxycyclohexyl)urea may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its unique structure could lead to specific binding interactions with biological targets, potentially influencing its efficacy and safety profile in therapeutic applications. As with many organic compounds, its stability, reactivity, and interactions will depend on environmental conditions such as pH and temperature.

Formula: C₉H₁₈N₂O₂

InChI: InChI=1/C9H18N2O2/c1-2-10-9(13)11-7-3-5-8(12)6-4-7/h7-8,12H,2-6H2,1H3,(H2,10,11,13)/t7-,8-

InChI key: InChIKey=BDIMVNHBVCPOFN-ZKCHVHJHNA-N

SMILES: N(C(NCC)=O)[C@@H]1CC[C@@H](O)CC1

Synonyms:

• N-Ethyl-N′-(trans-4-hydroxycyclohexyl)urea
• Urea, N-ethyl-N′-(trans-4-hydroxycyclohexyl)-
• 1-Ethyl-3-((1R,4R)-4-hydroxycyclohexyl)urea
• 1-Ethyl-3-(4-hydroxycyclohexyl)urea (trans)