CymitQuimica logo

CAS 1241675-80-8

:

5H-1,4-Diazepin-5-one, hexahydro-4-propyl-, hydrochloride (1:1)

Description:
5H-1,4-Diazepin-5-one, hexahydro-4-propyl-, hydrochloride (1:1) is a chemical compound characterized by its diazepine structure, which consists of a seven-membered ring containing two nitrogen atoms. This compound features a hexahydro-4-propyl substituent, indicating the presence of a propyl group attached to the diazepine ring, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit biological activity, potentially influencing neurotransmitter systems, which is common among diazepine derivatives. Its molecular structure suggests it could be involved in interactions with receptors in the central nervous system. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound represents a specific class of nitrogen-containing heterocycles with potential therapeutic applications, warranting further investigation into its pharmacological properties and mechanisms of action.
Formula:C8H16N2O·ClH
InChI:InChI=1S/C8H16N2O.ClH/c1-2-6-10-7-5-9-4-3-8(10)11;/h9H,2-7H2,1H3;1H
InChI key:InChIKey=UBQTWXBEKIVMJG-UHFFFAOYSA-N
SMILES:C(CC)N1C(=O)CCNCC1.Cl
Synonyms:
  • 5H-1,4-Diazepin-5-one, hexahydro-4-propyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.