
CAS 1241675-81-9
:rel-5-Chloro-2-[(2R,6S)-2,6-dimethyl-4-morpholinyl]benzaldehyde
Description:
Rel-5-Chloro-2-[(2R,6S)-2,6-dimethyl-4-morpholinyl]benzaldehyde is a chemical compound characterized by its specific structural features, including a benzaldehyde moiety and a morpholine ring. The presence of a chlorine atom at the 5-position of the benzene ring contributes to its reactivity and potential applications in organic synthesis. The compound exhibits chirality due to the presence of a stereogenic center in the morpholine substituent, which can influence its biological activity and interactions. Typically, compounds of this nature may be investigated for their potential as pharmaceuticals or agrochemicals, given the functional groups that can participate in various chemical reactions. The molecular structure suggests that it may engage in hydrogen bonding and other intermolecular interactions, affecting its solubility and stability in different solvents. As with many organic compounds, its properties such as melting point, boiling point, and solubility would be essential for practical applications and would need to be determined experimentally. Safety data and handling precautions are also critical for working with this substance in a laboratory setting.
Formula:C13H16ClNO2
InChI:InChI=1/C13H16ClNO2/c1-9-6-15(7-10(2)17-9)13-4-3-12(14)5-11(13)8-16/h3-5,8-10H,6-7H2,1-2H3/t9-,10+
InChI key:InChIKey=DCYDQVKYKLVSHT-AOOOYVTPNA-N
SMILES:C(=O)C1=C(N2C[C@@H](C)O[C@@H](C)C2)C=CC(Cl)=C1
Synonyms:- Benzaldehyde, 5-chloro-2-[(2R,6S)-2,6-dimethyl-4-morpholinyl]-, rel-
- rel-5-Chloro-2-[(2R,6S)-2,6-dimethyl-4-morpholinyl]benzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.