CAS 1241675-83-1

1H-Benzimidazole, 6-chloro-2-(4-piperidinyl)-, hydrochloride (1:2)

Description:

1H-Benzimidazole, 6-chloro-2-(4-piperidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing a fused benzene and imidazole ring. The presence of a chlorine atom at the 6-position and a piperidine group at the 2-position contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its applicability in pharmaceutical formulations. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. The compound's molecular weight, solubility, and stability are influenced by its specific functional groups and the hydrochloride form. Safety and handling precautions are essential, as with any chemical, particularly in laboratory or industrial settings. Further research is necessary to fully elucidate its properties and potential uses in drug development or other applications.

Formula: C₁₂H₁₄ClN₃·2ClH

InChI: InChI=1S/C12H14ClN3.2ClH/c13-9-1-2-10-11(7-9)16-12(15-10)8-3-5-14-6-4-8;;/h1-2,7-8,14H,3-6H2,(H,15,16);2*1H

InChI key: InChIKey=WJXXZXXHZJYMIZ-UHFFFAOYSA-N

SMILES: ClC=1C=C2N=C(NC2=CC1)C3CCNCC3.Cl

Synonyms:

• 1H-Benzimidazole, 6-chloro-2-(4-piperidinyl)-, hydrochloride (1:2)

5-Chloro-2-piperidin-4-yl-1h-benzimidazole dihydrochloride

CAS: 1241675-83-1

Formula: C₁₂H₁₆Cl₃N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 308.6345

Ref: IN-DA003AVM

6-Chloro-2-(piperidin-4-yl)-1H-benzo[d]imidazole dihydrochloride

CAS: 1241675-83-1

Purity: 95%

Molecular weight: 308.6300049

Ref: 10-F731990