CAS 1241675-85-3

1H-Isoindole-1,3(2H)-dione, 2-(3-amino-2-oxopropyl)-, hydrochloride (1:1)

Description:

1H-Isoindole-1,3(2H)-dione, 2-(3-amino-2-oxopropyl)-, hydrochloride (1:1), with CAS number 1241675-85-3, is a chemical compound characterized by its isoindole structure, which features a bicyclic framework consisting of a five-membered ring fused to a six-membered ring. This compound contains a dione functional group, indicating the presence of two carbonyl groups, which contributes to its reactivity and potential biological activity. The presence of the amino group suggests that it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for pharmaceutical applications. The compound may exhibit properties relevant to medicinal chemistry, potentially acting as an intermediate in drug synthesis or possessing pharmacological activity. Its specific characteristics, such as melting point, solubility, and spectral data, would require further investigation through experimental methods or literature to provide a comprehensive understanding of its behavior in different environments.

Formula: C₁₁H₁₀N₂O₃·ClH

InChI: InChI=1S/C11H10N2O3.ClH/c12-5-7(14)6-13-10(15)8-3-1-2-4-9(8)11(13)16;/h1-4H,5-6,12H2;1H

InChI key: InChIKey=LPLKYGBGRRHCAT-UHFFFAOYSA-N

SMILES: O=C1C=2C(C(=O)N1CC(CN)=O)=CC=CC2.Cl

Synonyms:

• 1H-Isoindole-1,3(2H)-dione, 2-(3-amino-2-oxopropyl)-, hydrochloride (1:1)