
CAS 1241676-85-6
:(4S)-7,8-Dichloro-3,4-dihydro-2H-1-benzopyran-4-amine
Description:
(4S)-7,8-Dichloro-3,4-dihydro-2H-1-benzopyran-4-amine is a chemical compound characterized by its unique structural features, including a benzopyran core, which is a fused ring system comprising a benzene ring and a pyran ring. The presence of two chlorine atoms at the 7 and 8 positions contributes to its halogenated nature, potentially influencing its reactivity and biological activity. The amine functional group at the 4 position suggests that the compound may exhibit basic properties and could participate in hydrogen bonding. The stereochemistry indicated by the (4S) designation implies a specific three-dimensional arrangement of atoms, which can significantly affect the compound's interactions with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity stemming from its structural characteristics. Its solubility, stability, and reactivity would depend on the specific conditions and solvents used in experiments or applications.
Formula:C9H9Cl2NO
InChI:InChI=1S/C9H9Cl2NO/c10-6-2-1-5-7(12)3-4-13-9(5)8(6)11/h1-2,7H,3-4,12H2/t7-/m0/s1
InChI key:InChIKey=WUGRPYNFTPEPAC-ZETCQYMHSA-N
SMILES:ClC1=C2C([C@@H](N)CCO2)=CC=C1Cl
Synonyms:- (4S)-7,8-Dichloro-3,4-dihydro-2H-1-benzopyran-4-amine
- 2H-1-Benzopyran-4-amine, 7,8-dichloro-3,4-dihydro-, (4S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.