
CAS 1241678-08-9
:1,1-Dimethylethyl (3S)-3-(1,3-benzodioxol-5-yl)-1-piperazinecarboxylate
Description:
1,1-Dimethylethyl (3S)-3-(1,3-benzodioxol-5-yl)-1-piperazinecarboxylate, identified by its CAS number 1241678-08-9, is a chemical compound characterized by its complex structure, which includes a piperazine ring and a benzodioxole moiety. This compound features a tert-butyl group (1,1-dimethylethyl) that contributes to its steric properties, potentially influencing its biological activity and solubility. The presence of the benzodioxole structure suggests potential interactions with biological targets, as this moiety is often associated with various pharmacological activities. The piperazine ring is known for its role in medicinal chemistry, frequently appearing in compounds with anxiolytic, antidepressant, and antipsychotic properties. The specific stereochemistry at the 3-position of the piperazine indicates that the compound may exhibit chirality, which can significantly affect its pharmacodynamics and pharmacokinetics. Overall, this compound's unique structural features suggest potential applications in drug development, although further studies would be necessary to elucidate its specific biological effects and therapeutic potential.
Formula:C16H22N2O4
InChI:InChI=1S/C16H22N2O4/c1-16(2,3)22-15(19)18-7-6-17-12(9-18)11-4-5-13-14(8-11)21-10-20-13/h4-5,8,12,17H,6-7,9-10H2,1-3H3/t12-/m1/s1
InChI key:InChIKey=XLPLNERULMLZNH-GFCCVEGCSA-N
SMILES:C(OC(C)(C)C)(=O)N1C[C@H](C=2C=C3C(=CC2)OCO3)NCC1
Synonyms:- 1-Piperazinecarboxylic acid, 3-(1,3-benzodioxol-5-yl)-, 1,1-dimethylethyl ester, (3S)-
- 1,1-Dimethylethyl (3S)-3-(1,3-benzodioxol-5-yl)-1-piperazinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.