CAS 1241679-20-8

2-[(1R)-1-Aminoethyl]-4,6-difluorophenol

Description:

2-[(1R)-1-Aminoethyl]-4,6-difluorophenol is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring that is further substituted with two fluorine atoms at the 4 and 6 positions. The presence of the aminoethyl group at the 2-position contributes to its potential as a biological or pharmaceutical agent. This compound is likely to exhibit polar characteristics due to the hydroxyl and amino groups, which can engage in hydrogen bonding, influencing its solubility in water and organic solvents. The difluorophenol moiety may impart unique electronic properties, affecting its reactivity and interaction with biological targets. Additionally, the stereochemistry indicated by the (1R) configuration suggests that the compound may exhibit specific chiral properties, which can be crucial in determining its biological activity and pharmacokinetics. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutics targeting specific biological pathways.

Formula: C₈H₉F₂NO

InChI: InChI=1S/C8H9F2NO/c1-4(11)6-2-5(9)3-7(10)8(6)12/h2-4,12H,11H2,1H3/t4-/m1/s1

InChI key: InChIKey=KQTCENUBEJTCLA-SCSAIBSYSA-N

SMILES: [C@H](C)(N)C1=C(O)C(F)=CC(F)=C1

Synonyms:

• Phenol, 2-[(1R)-1-aminoethyl]-4,6-difluoro-
• 2-[(1R)-1-Aminoethyl]-4,6-difluorophenol