CymitQuimica logo

CAS 1241679-51-5

:

(1S)-5,7-Difluoro-1,2,3,4-tetrahydro-1-naphthalenamine

Description:
(1S)-5,7-Difluoro-1,2,3,4-tetrahydro-1-naphthalenamine is a chemical compound characterized by its unique structure, which includes a naphthalene ring system that has been partially saturated and substituted with fluorine atoms. The presence of two fluorine atoms at the 5 and 7 positions of the naphthalene ring contributes to its distinct chemical properties, such as increased lipophilicity and potential biological activity. The amine functional group indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. This compound is of interest in medicinal chemistry and drug development due to its potential pharmacological properties. Its stereochemistry, denoted by the (1S) configuration, suggests specific spatial arrangements that can affect its interaction with biological targets. Overall, (1S)-5,7-Difluoro-1,2,3,4-tetrahydro-1-naphthalenamine is a fluorinated amine with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C10H11F2N
InChI:InChI=1S/C10H11F2N/c11-6-4-8-7(9(12)5-6)2-1-3-10(8)13/h4-5,10H,1-3,13H2/t10-/m0/s1
InChI key:InChIKey=CUGDJBUUTWZPCY-JTQLQIEISA-N
SMILES:FC1=C2C(=CC(F)=C1)[C@@H](N)CCC2
Synonyms:
  • 1-Naphthalenamine, 5,7-difluoro-1,2,3,4-tetrahydro-, (1S)-
  • (1S)-5,7-Difluoro-1,2,3,4-tetrahydro-1-naphthalenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.