CAS 1241680-67-0

(αS)-α-Amino-3′-methyl[1,1′-biphenyl]-4-propanoic acid

Description:

(αS)-α-Amino-3′-methyl[1,1′-biphenyl]-4-propanoic acid, identified by its CAS number 1241680-67-0, is a chiral amino acid derivative characterized by its biphenyl structure, which contributes to its unique properties. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), typical of amino acids, allowing it to participate in various biochemical reactions. The presence of the methyl group at the 3′ position of the biphenyl moiety enhances its hydrophobic characteristics, potentially influencing its interactions with biological systems. Its stereochemistry, denoted by the (αS) configuration, indicates that it has specific spatial arrangements that can affect its biological activity and interactions with receptors or enzymes. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways or in the synthesis of peptide-based therapeutics. As with many amino acid derivatives, it may exhibit solubility in polar solvents and could participate in hydrogen bonding due to its functional groups.

Formula: C₁₆H₁₇NO₂

InChI: InChI=1S/C16H17NO2/c1-11-3-2-4-14(9-11)13-7-5-12(6-8-13)10-15(17)16(18)19/h2-9,15H,10,17H2,1H3,(H,18,19)/t15-/m0/s1

InChI key: InChIKey=KNGPCDWTKTUSBB-HNNXBMFYSA-N

SMILES: CC=1C=C(C2=CC=C(C[C@@H](C(O)=O)N)C=C2)C=CC1

Synonyms:

• (αS)-α-Amino-3′-methyl[1,1′-biphenyl]-4-propanoic acid
• [1,1′-Biphenyl]-4-propanoic acid, α-amino-3′-methyl-, (αS)-