
CAS 1241681-88-8
:4-[(1S)-1-Aminoethyl]-2-methoxyphenol
Description:
4-[(1S)-1-Aminoethyl]-2-methoxyphenol, also known by its CAS number 1241681-88-8, is an organic compound characterized by its phenolic structure, which includes a methoxy group and an aminoethyl substituent. This compound features a chiral center, making it optically active, with the (1S) configuration indicating the specific spatial arrangement of its atoms. The presence of the methoxy group contributes to its solubility and reactivity, while the amino group can participate in hydrogen bonding and may influence its biological activity. Typically, compounds of this nature may exhibit properties such as antioxidant activity or potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Its molecular interactions can be influenced by pH and solvent conditions, which are critical for understanding its behavior in various chemical environments. Overall, 4-[(1S)-1-Aminoethyl]-2-methoxyphenol represents a class of compounds with diverse applications in medicinal chemistry and biochemistry.
Formula:C9H13NO2
InChI:InChI=1S/C9H13NO2/c1-6(10)7-3-4-8(11)9(5-7)12-2/h3-6,11H,10H2,1-2H3/t6-/m0/s1
InChI key:InChIKey=CCUOPHCFZGJEKT-LURJTMIESA-N
SMILES:O(C)C1=CC([C@H](C)N)=CC=C1O
Synonyms:- 4-[(1S)-1-Aminoethyl]-2-methoxyphenol
- Phenol, 4-[(1S)-1-aminoethyl]-2-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.