CAS 1241683-26-0

(αR)-α-Cyclobutylbenzenemethanamine

Description:

(αR)-α-Cyclobutylbenzenemethanamine is a chemical compound characterized by its unique structure, which features a cyclobutyl group attached to a benzene ring, with an amine functional group. This compound belongs to the class of amines and is likely to exhibit properties typical of such compounds, including basicity due to the presence of the amine group. The stereochemistry indicated by the (αR) designation suggests that it has a specific spatial arrangement, which can influence its reactivity and interactions with biological systems. The cyclobutyl moiety may impart strain and rigidity to the molecule, potentially affecting its conformational dynamics. Additionally, the presence of both hydrophobic (the cyclobutyl and benzene groups) and polar (the amine group) regions in the molecule suggests that it may engage in various types of intermolecular interactions, such as hydrogen bonding and hydrophobic interactions. These characteristics can influence its solubility, reactivity, and potential applications in pharmaceuticals or materials science.

Formula: C₁₁H₁₅N

InChI: InChI=1S/C11H15N/c12-11(10-7-4-8-10)9-5-2-1-3-6-9/h1-3,5-6,10-11H,4,7-8,12H2/t11-/m0/s1

InChI key: InChIKey=YVAXXHNMTBNQFD-NSHDSACASA-N

SMILES: [C@@H](N)(C1CCC1)C2=CC=CC=C2

Synonyms:

• Benzenemethanamine, α-cyclobutyl-, (αR)-
• (R)-Cyclobutyl(phenyl)methanamine
• (αR)-α-Cyclobutylbenzenemethanamine