CAS 1241684-13-8

(1R)-5,7-Difluoro-1,2,3,4-tetrahydro-1-naphthalenamine

Description:

(1R)-5,7-Difluoro-1,2,3,4-tetrahydro-1-naphthalenamine is a chemical compound characterized by its unique structure, which includes a naphthalene ring system that has been partially saturated and substituted with fluorine atoms. The presence of the two fluorine atoms at the 5 and 7 positions of the naphthalene ring contributes to its distinct chemical properties, such as increased lipophilicity and potential biological activity. The amine functional group indicates that the compound can participate in hydrogen bonding, influencing its solubility and reactivity. This compound is of interest in medicinal chemistry and drug development due to its potential pharmacological properties. Its stereochemistry, indicated by the (1R) designation, suggests specific spatial arrangements that can affect its interaction with biological targets. Overall, (1R)-5,7-Difluoro-1,2,3,4-tetrahydro-1-naphthalenamine represents a class of compounds that may exhibit significant therapeutic potential, warranting further investigation into its applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₀H₁₁F₂N

InChI: InChI=1S/C10H11F2N/c11-6-4-8-7(9(12)5-6)2-1-3-10(8)13/h4-5,10H,1-3,13H2/t10-/m1/s1

InChI key: InChIKey=CUGDJBUUTWZPCY-SNVBAGLBSA-N

SMILES: FC1=C2C(=CC(F)=C1)[C@H](N)CCC2

Synonyms:

• (1R)-5,7-Difluoro-1,2,3,4-tetrahydro-1-naphthalenamine
• 1-Naphthalenamine, 5,7-difluoro-1,2,3,4-tetrahydro-, (1R)-