CymitQuimica logo

CAS 1241684-14-9

:

(1R)-5,7-Dichloro-1,2,3,4-tetrahydro-1-naphthalenamine

Description:
(1R)-5,7-Dichloro-1,2,3,4-tetrahydro-1-naphthalenamine is a chemical compound characterized by its bicyclic structure, which includes a naphthalene core modified by the presence of two chlorine atoms and an amine functional group. The "1R" designation indicates that the compound has a specific stereochemistry, which can influence its biological activity and interactions. The dichloro substitution at the 5 and 7 positions of the naphthalene ring contributes to its reactivity and potential applications in medicinal chemistry. This compound may exhibit properties such as being a potential intermediate in the synthesis of pharmaceuticals or agrochemicals. Its tetrahydro configuration suggests that it is a saturated derivative of naphthalene, which can affect its solubility and stability. As with many halogenated compounds, it may also possess unique electronic properties that could be exploited in various chemical reactions. Safety and handling precautions are essential due to the presence of chlorine, which can impart toxicity and environmental concerns.
Formula:C10H11Cl2N
InChI:InChI=1S/C10H11Cl2N/c11-6-4-8-7(9(12)5-6)2-1-3-10(8)13/h4-5,10H,1-3,13H2/t10-/m1/s1
InChI key:InChIKey=ZDKDCHIVZVZNMV-SNVBAGLBSA-N
SMILES:ClC1=C2C(=CC(Cl)=C1)[C@H](N)CCC2
Synonyms:
  • (1R)-5,7-Dichloro-1,2,3,4-tetrahydro-1-naphthalenamine
  • 1-Naphthalenamine, 5,7-dichloro-1,2,3,4-tetrahydro-, (1R)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.