CAS 1241684-15-0

(1S)-5,7-Dichloro-1,2,3,4-tetrahydro-1-naphthalenamine

Description:

(1S)-5,7-Dichloro-1,2,3,4-tetrahydro-1-naphthalenamine is a chemical compound characterized by its unique structure, which includes a naphthalene ring system that has been partially saturated and substituted with chlorine atoms and an amine group. The presence of the two chlorine atoms at the 5 and 7 positions of the naphthalene ring contributes to its reactivity and potential biological activity. The tetrahydro configuration indicates that the compound has undergone hydrogenation, resulting in a saturated cyclic structure that can influence its physical and chemical properties, such as solubility and stability. As an amine, it may exhibit basic properties and can participate in various chemical reactions, including nucleophilic substitutions. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate potential hazards associated with its use.

Formula: C₁₀H₁₁Cl₂N

InChI: InChI=1S/C10H11Cl2N/c11-6-4-8-7(9(12)5-6)2-1-3-10(8)13/h4-5,10H,1-3,13H2/t10-/m0/s1

InChI key: InChIKey=ZDKDCHIVZVZNMV-JTQLQIEISA-N

SMILES: ClC1=C2C(=CC(Cl)=C1)[C@@H](N)CCC2

Synonyms:

• 1-Naphthalenamine, 5,7-dichloro-1,2,3,4-tetrahydro-, (1S)-
• (1S)-5,7-Dichloro-1,2,3,4-tetrahydro-1-naphthalenamine