CymitQuimica logo

CAS 1241684-17-2

:

(2S,3R)-2-Phenyl-3-pyrrolidinecarboxylic acid

Description:
(2S,3R)-2-Phenyl-3-pyrrolidinecarboxylic acid is a chiral compound characterized by its specific stereochemistry, indicated by the (2S,3R) configuration. This compound features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and a phenyl group, which contributes to its aromatic properties. The presence of the carboxylic acid functional group (-COOH) imparts acidic characteristics, making it capable of participating in various chemical reactions, such as esterification and amidation. The stereochemistry of this compound is significant in biological contexts, as it may influence its interaction with biological receptors or enzymes. Additionally, the compound's solubility and reactivity can be affected by its chirality, which is crucial in pharmaceutical applications where enantiomeric purity can impact efficacy and safety. Overall, (2S,3R)-2-Phenyl-3-pyrrolidinecarboxylic acid is of interest in medicinal chemistry and may serve as a building block for the synthesis of more complex molecules.
Formula:C11H13NO2
InChI:InChI=1S/C11H13NO2/c13-11(14)9-6-7-12-10(9)8-4-2-1-3-5-8/h1-5,9-10,12H,6-7H2,(H,13,14)/t9-,10-/m1/s1
InChI key:InChIKey=DQOBFNNHIKEOLB-NXEZZACHSA-N
SMILES:C(O)(=O)[C@H]1[C@H](NCC1)C2=CC=CC=C2
Synonyms:
  • 3-Pyrrolidinecarboxylic acid, 2-phenyl-, (2S,3R)-
  • (2S,3R)-2-Phenyl-3-pyrrolidinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.