CymitQuimica logo

CAS 124170-23-6

:

2-fluoro-3,3-dim.-2,3-dihyd-1,2-benziso-thiazole 1,1-dioxide

Description:
2-Fluoro-3,3-dimethyl-2,3-dihydro-1,2-benzisothiazole 1,1-dioxide, with the CAS number 124170-23-6, is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both a benzene ring and a thiazole moiety. The presence of a fluorine atom and two methyl groups on the thiazole ring contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the benzisothiazole framework, which is known for various biological activities. The 1,1-dioxide functional group may enhance its stability and influence its interaction with biological targets. As with many heterocycles, the compound's properties, such as melting point, boiling point, and reactivity, can vary significantly based on the specific substituents and their positions on the ring system.
Formula:C9H10FNO2S
InChI:InChI=1/C9H10FNO2S/c1-9(2)7-5-3-4-6-8(7)14(12,13)11(9)10/h3-6H,1-2H3
SMILES:CC1(C)c2ccccc2S(=O)(=O)N1F
Synonyms:
  • 2-Fluoro-3,3-dimethyl-2,3-dihydro-1,2-benzisothiazole 1,1-dioxide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.